C23H38O3 — CID 118535585
(2R,3R,3aS,5Z,11aR)-2-hydroxy-3-(3-oxodecyl)-1,2,3,3a,4,7,8,9,11,11a-decahydrocyclopenta[10]annulen-10-one (PubChem CID 118535585) has the molecular formula C23H38O3 and a molecular weight of 362.55 g/mol. Its IUPAC name is (2R,3R,3aS,5Z,11aR)-2-hydroxy-3-(3-oxodecyl)-1,2,3,3a,4,7,8,9,11,11a-decahydrocyclopenta[10]annulen-10-one.
| Compound Name | (2R,3R,3aS,5Z,11aR)-2-hydroxy-3-(3-oxodecyl)-1,2,3,3a,4,7,8,9,11,11a-decahydrocyclopenta[10]annulen-10-one |
|---|---|
| PubChem CID | 118535585 |
| Molecular Formula | C23H38O3 |
| Molecular Weight | 362.55 g/mol |
| Exact Mass | 362.28 |
| IUPAC Name | (2R,3R,3aS,5Z,11aR)-2-hydroxy-3-(3-oxodecyl)-1,2,3,3a,4,7,8,9,11,11a-decahydrocyclopenta[10]annulen-10-one |
| SMILES | CCCCCCCC(=O)CC[C@@H]1[C@H]2C/C=C\CCCC(=O)C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C23H38O3/c1-2-3-4-5-8-11-19(24)14-15-22-21-13-10-7-6-9-12-20(25)16-18(21)17-23(22)26/h7,10,18,21-23,26H,2-6,8-9,11-17H2,1H3/b10-7-/t18-,21-,22+,23+/m0/s1 |
| InChIKey | DYPSOVKJLLKZPZ-DWMKAUEJSA-N |
| XLogP | 5.40 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.55 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|