C31H48O5 — CID 145001014
octyl 2-[[(1R,2R,3aS,9aS)-2-hydroxy-1-(3-oxooctyl)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate (PubChem CID 145001014) has the molecular formula C31H48O5 and a molecular weight of 500.72 g/mol. Its IUPAC name is octyl 2-[[(1R,2R,3aS,9aS)-2-hydroxy-1-(3-oxooctyl)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate.
| Compound Name | octyl 2-[[(1R,2R,3aS,9aS)-2-hydroxy-1-(3-oxooctyl)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate |
|---|---|
| PubChem CID | 145001014 |
| Molecular Formula | C31H48O5 |
| Molecular Weight | 500.72 g/mol |
| Exact Mass | 500.35 |
| IUPAC Name | octyl 2-[[(1R,2R,3aS,9aS)-2-hydroxy-1-(3-oxooctyl)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate |
| SMILES | CCCCCCCCOC(=O)COc1cccc2c1C[C@H]1C[C@@H](O)[C@H](CCC(=O)CCCCC)[C@H]1C2 |
| InChI | InChI=1S/C31H48O5/c1-3-5-7-8-9-11-18-35-31(34)22-36-30-15-12-13-23-19-27-24(20-28(23)30)21-29(33)26(27)17-16-25(32)14-10-6-4-2/h12-13,15,24,26-27,29,33H,3-11,14,16-22H2,1-2H3/t24-,26+,27-,29+/m0/s1 |
| InChIKey | WWCQMTXNRTXAEZ-DXLYGPJMSA-N |
| XLogP | 6.61 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.72 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|