C21H28O7 — CID 138487132
2-[[(1R,2R,3aS,9aS)-1-(3-ethoxycarbonyloxypropyl)-2-hydroxy-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetic acid (PubChem CID 138487132) has the molecular formula C21H28O7 and a molecular weight of 392.45 g/mol. Its IUPAC name is 2-[[(1R,2R,3aS,9aS)-1-(3-ethoxycarbonyloxypropyl)-2-hydroxy-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetic acid.
| Compound Name | 2-[[(1R,2R,3aS,9aS)-1-(3-ethoxycarbonyloxypropyl)-2-hydroxy-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 138487132 |
| Molecular Formula | C21H28O7 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 2-[[(1R,2R,3aS,9aS)-1-(3-ethoxycarbonyloxypropyl)-2-hydroxy-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetic acid |
| SMILES | CCOC(=O)OCCC[C@@H]1[C@H]2Cc3cccc(OCC(=O)O)c3C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C21H28O7/c1-2-26-21(25)27-8-4-6-15-16-9-13-5-3-7-19(28-12-20(23)24)17(13)10-14(16)11-18(15)22/h3,5,7,14-16,18,22H,2,4,6,8-12H2,1H3,(H,23,24)/t14-,15+,16-,18+/m0/s1 |
| InChIKey | DYXSGDJVDBBUSV-UIBIWLFHSA-N |
| XLogP | 2.82 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|