C24H28O4 — CID 138726485
benzyl 2-[[(1S,2S)-1-ethyl-2-hydroxy-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate (PubChem CID 138726485) has the molecular formula C24H28O4 and a molecular weight of 380.48 g/mol. Its IUPAC name is benzyl 2-[[(1S,2S)-1-ethyl-2-hydroxy-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate.
| Compound Name | benzyl 2-[[(1S,2S)-1-ethyl-2-hydroxy-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate |
|---|---|
| PubChem CID | 138726485 |
| Molecular Formula | C24H28O4 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | benzyl 2-[[(1S,2S)-1-ethyl-2-hydroxy-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate |
| SMILES | CC[C@H]1C2Cc3cccc(OCC(=O)OCc4ccccc4)c3CC2C[C@@H]1O |
| InChI | InChI=1S/C24H28O4/c1-2-19-20-11-17-9-6-10-23(21(17)12-18(20)13-22(19)25)27-15-24(26)28-14-16-7-4-3-5-8-16/h3-10,18-20,22,25H,2,11-15H2,1H3/t18?,19-,20?,22-/m0/s1 |
| InChIKey | MMXHKNYHBAMWHO-OYZUSSLQSA-N |
| XLogP | 3.93 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |