C37H53ClO6Si — CID 156625857
benzyl 2-[[(1R,2R,3aS,9aS)-1-[(3S)-3-carbonochloridoyloxyoctyl]-2-triethylsilyloxy-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate (PubChem CID 156625857) has the molecular formula C37H53ClO6Si and a molecular weight of 657.36 g/mol. Its IUPAC name is benzyl 2-[[(1R,2R,3aS,9aS)-1-[(3S)-3-carbonochloridoyloxyoctyl]-2-triethylsilyloxy-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate.
| Compound Name | benzyl 2-[[(1R,2R,3aS,9aS)-1-[(3S)-3-carbonochloridoyloxyoctyl]-2-triethylsilyloxy-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate |
|---|---|
| PubChem CID | 156625857 |
| Molecular Formula | C37H53ClO6Si |
| Molecular Weight | 657.36 g/mol |
| Exact Mass | 656.33 |
| IUPAC Name | benzyl 2-[[(1R,2R,3aS,9aS)-1-[(3S)-3-carbonochloridoyloxyoctyl]-2-triethylsilyloxy-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate |
| SMILES | CCCCC[C@@H](CC[C@@H]1[C@H]2Cc3cccc(OCC(=O)OCc4ccccc4)c3C[C@H]2C[C@H]1O[Si](CC)(CC)CC)OC(=O)Cl |
| InChI | InChI=1S/C37H53ClO6Si/c1-5-9-11-18-30(43-37(38)40)20-21-31-32-22-28-17-14-19-34(41-26-36(39)42-25-27-15-12-10-13-16-27)33(28)23-29(32)24-35(31)44-45(6-2,7-3)8-4/h10,12-17,19,29-32,35H,5-9,11,18,20-26H2,1-4H3/t29-,30-,31+,32-,35+/m0/s1 |
| InChIKey | FQOIIOPWVRRDBF-RSENBJTISA-N |
| XLogP | 9.65 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.36 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|