C45H65NO7Si — CID 91437422
benzyl 2-[[2-[tert-butyl(dimethyl)silyl]oxy-1-(3-hydroxyoctyl)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate;benzyl N-methylcarbamate (PubChem CID 91437422) has the molecular formula C45H65NO7Si and a molecular weight of 760.10 g/mol. Its IUPAC name is benzyl 2-[[2-[tert-butyl(dimethyl)silyl]oxy-1-(3-hydroxyoctyl)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate;benzyl N-methylcarbamate.
| Compound Name | benzyl 2-[[2-[tert-butyl(dimethyl)silyl]oxy-1-(3-hydroxyoctyl)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate;benzyl N-methylcarbamate |
|---|---|
| PubChem CID | 91437422 |
| Molecular Formula | C45H65NO7Si |
| Molecular Weight | 760.10 g/mol |
| Exact Mass | 759.45 |
| IUPAC Name | benzyl 2-[[2-[tert-butyl(dimethyl)silyl]oxy-1-(3-hydroxyoctyl)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate;benzyl N-methylcarbamate |
| SMILES | CCCCCC(O)CCC1C(O[Si](C)(C)C(C)(C)C)CC2Cc3c(cccc3OCC(=O)OCc3ccccc3)CC21.CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C36H54O5Si.C9H11NO2/c1-7-8-10-17-29(37)19-20-30-31-21-27-16-13-18-33(39-25-35(38)40-24-26-14-11-9-12-15-26)32(27)22-28(31)23-34(30)41-42(5,6)36(2,3)4;1-10-9(11)12-7-8-5-3-2-4-6-8/h9,11-16,18,28-31,34,37H,7-8,10,17,19-25H2,1-6H3;2-6H,7H2,1H3,(H,10,11) |
| InChIKey | KPJBYEXJAWDNPH-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.10 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|