C38H46O7 — CID 134170314
benzyl 2-[[(1R,2R,3aS,9aS)-1-[(3S)-3-hydroxyoctyl]-2-phenylmethoxycarbonyloxy-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate (PubChem CID 134170314) has the molecular formula C38H46O7 and a molecular weight of 614.78 g/mol. Its IUPAC name is benzyl 2-[[(1R,2R,3aS,9aS)-1-[(3S)-3-hydroxyoctyl]-2-phenylmethoxycarbonyloxy-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate.
| Compound Name | benzyl 2-[[(1R,2R,3aS,9aS)-1-[(3S)-3-hydroxyoctyl]-2-phenylmethoxycarbonyloxy-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate |
|---|---|
| PubChem CID | 134170314 |
| Molecular Formula | C38H46O7 |
| Molecular Weight | 614.78 g/mol |
| Exact Mass | 614.32 |
| IUPAC Name | benzyl 2-[[(1R,2R,3aS,9aS)-1-[(3S)-3-hydroxyoctyl]-2-phenylmethoxycarbonyloxy-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate |
| SMILES | CCCCC[C@H](O)CC[C@@H]1[C@H]2Cc3cccc(OCC(=O)OCc4ccccc4)c3C[C@H]2C[C@H]1OC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C38H46O7/c1-2-3-6-17-31(39)19-20-32-33-21-29-16-11-18-35(42-26-37(40)43-24-27-12-7-4-8-13-27)34(29)22-30(33)23-36(32)45-38(41)44-25-28-14-9-5-10-15-28/h4-5,7-16,18,30-33,36,39H,2-3,6,17,19-26H2,1H3/t30-,31-,32+,33-,36+/m0/s1 |
| InChIKey | PESXHOXEEJKTPT-SPAFBDMYSA-N |
| XLogP | 7.60 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.78 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|