C28H42O8 — CID 135139737
2-[[(1R,2R,3aS,9aS)-1-[(3S)-3-hydroxyoctyl]-2-[2-(2-methoxyethoxy)acetyl]oxy-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetic acid (PubChem CID 135139737) has the molecular formula C28H42O8 and a molecular weight of 506.64 g/mol. Its IUPAC name is 2-[[(1R,2R,3aS,9aS)-1-[(3S)-3-hydroxyoctyl]-2-[2-(2-methoxyethoxy)acetyl]oxy-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetic acid.
| Compound Name | 2-[[(1R,2R,3aS,9aS)-1-[(3S)-3-hydroxyoctyl]-2-[2-(2-methoxyethoxy)acetyl]oxy-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 135139737 |
| Molecular Formula | C28H42O8 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | 2-[[(1R,2R,3aS,9aS)-1-[(3S)-3-hydroxyoctyl]-2-[2-(2-methoxyethoxy)acetyl]oxy-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetic acid |
| SMILES | CCCCC[C@H](O)CC[C@@H]1[C@H]2Cc3cccc(OCC(=O)O)c3C[C@H]2C[C@H]1OC(=O)COCCOC |
| InChI | InChI=1S/C28H42O8/c1-3-4-5-8-21(29)10-11-22-23-14-19-7-6-9-25(35-17-27(30)31)24(19)15-20(23)16-26(22)36-28(32)18-34-13-12-33-2/h6-7,9,20-23,26,29H,3-5,8,10-18H2,1-2H3,(H,30,31)/t20-,21-,22+,23-,26+/m0/s1 |
| InChIKey | LMPVJRKBVQXIKB-FMLGWJCWSA-N |
| XLogP | 3.80 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|