C23H32O6 — CID 121485783
2-[[(1R,2R,3aS,9aS)-1-[(3S)-3-hydroxypentyl]-2-propanoyloxy-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetic acid (PubChem CID 121485783) has the molecular formula C23H32O6 and a molecular weight of 404.50 g/mol. Its IUPAC name is 2-[[(1R,2R,3aS,9aS)-1-[(3S)-3-hydroxypentyl]-2-propanoyloxy-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetic acid.
| Compound Name | 2-[[(1R,2R,3aS,9aS)-1-[(3S)-3-hydroxypentyl]-2-propanoyloxy-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 121485783 |
| Molecular Formula | C23H32O6 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 2-[[(1R,2R,3aS,9aS)-1-[(3S)-3-hydroxypentyl]-2-propanoyloxy-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetic acid |
| SMILES | CCC(=O)O[C@@H]1C[C@@H]2Cc3c(cccc3OCC(=O)O)C[C@@H]2[C@H]1CC[C@@H](O)CC |
| InChI | InChI=1S/C23H32O6/c1-3-16(24)8-9-17-18-10-14-6-5-7-20(28-13-22(25)26)19(14)11-15(18)12-21(17)29-23(27)4-2/h5-7,15-18,21,24H,3-4,8-13H2,1-2H3,(H,25,26)/t15-,16-,17+,18-,21+/m0/s1 |
| InChIKey | BJZDTEBQIANPRS-HUTLKBDOSA-N |
| XLogP | 3.37 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |