C31H48O7 — CID 155634712
2-[[(1R,2R,3aS,9aS)-2-(2-ethoxyacetyl)oxy-1-[(3S)-3-hydroxydodecyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetic acid (PubChem CID 155634712) has the molecular formula C31H48O7 and a molecular weight of 532.72 g/mol. Its IUPAC name is 2-[[(1R,2R,3aS,9aS)-2-(2-ethoxyacetyl)oxy-1-[(3S)-3-hydroxydodecyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetic acid.
| Compound Name | 2-[[(1R,2R,3aS,9aS)-2-(2-ethoxyacetyl)oxy-1-[(3S)-3-hydroxydodecyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 155634712 |
| Molecular Formula | C31H48O7 |
| Molecular Weight | 532.72 g/mol |
| Exact Mass | 532.34 |
| IUPAC Name | 2-[[(1R,2R,3aS,9aS)-2-(2-ethoxyacetyl)oxy-1-[(3S)-3-hydroxydodecyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetic acid |
| SMILES | CCCCCCCCC[C@H](O)CC[C@@H]1[C@H]2Cc3cccc(OCC(=O)O)c3C[C@H]2C[C@H]1OC(=O)COCC |
| InChI | InChI=1S/C31H48O7/c1-3-5-6-7-8-9-10-13-24(32)15-16-25-26-17-22-12-11-14-28(37-20-30(33)34)27(22)18-23(26)19-29(25)38-31(35)21-36-4-2/h11-12,14,23-26,29,32H,3-10,13,15-21H2,1-2H3,(H,33,34)/t23-,24-,25+,26-,29+/m0/s1 |
| InChIKey | ZCBCPNIEYZUGLO-LGUFPPMKSA-N |
| XLogP | 5.73 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.72 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|