C28H46N2O7 — CID 59733200
methyl 2-[[2-(1-aminoethylperoxy)-1-[3-(1-aminoethylperoxy)octyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate (PubChem CID 59733200) has the molecular formula C28H46N2O7 and a molecular weight of 522.68 g/mol. Its IUPAC name is methyl 2-[[2-(1-aminoethylperoxy)-1-[3-(1-aminoethylperoxy)octyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate.
| Compound Name | methyl 2-[[2-(1-aminoethylperoxy)-1-[3-(1-aminoethylperoxy)octyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate |
|---|---|
| PubChem CID | 59733200 |
| Molecular Formula | C28H46N2O7 |
| Molecular Weight | 522.68 g/mol |
| Exact Mass | 522.33 |
| IUPAC Name | methyl 2-[[2-(1-aminoethylperoxy)-1-[3-(1-aminoethylperoxy)octyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate |
| SMILES | CCCCCC(CCC1C(OOC(C)N)CC2Cc3c(cccc3OCC(=O)OC)CC21)OOC(C)N |
| InChI | InChI=1S/C28H46N2O7/c1-5-6-7-10-22(36-34-18(2)29)12-13-23-24-14-20-9-8-11-26(33-17-28(31)32-4)25(20)15-21(24)16-27(23)37-35-19(3)30/h8-9,11,18-19,21-24,27H,5-7,10,12-17,29-30H2,1-4H3 |
| InChIKey | ZMXIRYFELLNITL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 124.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.68 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|