C31H47NO6 — CID 118147654
[(3S)-1-[(1R,2R,3aS,9aS)-2-hydroxy-5-(2-methoxy-2-oxoethoxy)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]naphthalen-1-yl]octan-3-yl] 1-methylpiperidine-2-carboxylate (PubChem CID 118147654) has the molecular formula C31H47NO6 and a molecular weight of 529.72 g/mol. Its IUPAC name is [(3S)-1-[(1R,2R,3aS,9aS)-2-hydroxy-5-(2-methoxy-2-oxoethoxy)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]naphthalen-1-yl]octan-3-yl] 1-methylpiperidine-2-carboxylate.
| Compound Name | [(3S)-1-[(1R,2R,3aS,9aS)-2-hydroxy-5-(2-methoxy-2-oxoethoxy)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]naphthalen-1-yl]octan-3-yl] 1-methylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 118147654 |
| Molecular Formula | C31H47NO6 |
| Molecular Weight | 529.72 g/mol |
| Exact Mass | 529.34 |
| IUPAC Name | [(3S)-1-[(1R,2R,3aS,9aS)-2-hydroxy-5-(2-methoxy-2-oxoethoxy)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]naphthalen-1-yl]octan-3-yl] 1-methylpiperidine-2-carboxylate |
| SMILES | CCCCC[C@@H](CC[C@@H]1[C@H]2Cc3cccc(OCC(=O)OC)c3C[C@H]2C[C@H]1O)OC(=O)C1CCCCN1C |
| InChI | InChI=1S/C31H47NO6/c1-4-5-6-11-23(38-31(35)27-12-7-8-16-32(27)2)14-15-24-25-17-21-10-9-13-29(37-20-30(34)36-3)26(21)18-22(25)19-28(24)33/h9-10,13,22-25,27-28,33H,4-8,11-12,14-20H2,1-3H3/t22-,23-,24+,25-,27?,28+/m0/s1 |
| InChIKey | MFJBWNXEJOVUQI-PRTGUZAYSA-N |
| XLogP | 4.71 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.72 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|