C37H63O9P — CID 176751979
butyl 2-[[(1R,2R,3aS,9aS)-1-[(3S)-3-(2-dibutoxyphosphoryloxyethoxy)octyl]-2-hydroxy-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate (PubChem CID 176751979) has the molecular formula C37H63O9P and a molecular weight of 682.88 g/mol. Its IUPAC name is butyl 2-[[(1R,2R,3aS,9aS)-1-[(3S)-3-(2-dibutoxyphosphoryloxyethoxy)octyl]-2-hydroxy-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate.
| Compound Name | butyl 2-[[(1R,2R,3aS,9aS)-1-[(3S)-3-(2-dibutoxyphosphoryloxyethoxy)octyl]-2-hydroxy-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate |
|---|---|
| PubChem CID | 176751979 |
| Molecular Formula | C37H63O9P |
| Molecular Weight | 682.88 g/mol |
| Exact Mass | 682.42 |
| IUPAC Name | butyl 2-[[(1R,2R,3aS,9aS)-1-[(3S)-3-(2-dibutoxyphosphoryloxyethoxy)octyl]-2-hydroxy-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate |
| SMILES | CCCCC[C@@H](CC[C@@H]1[C@H]2Cc3cccc(OCC(=O)OCCCC)c3C[C@H]2C[C@H]1O)OCCOP(=O)(OCCCC)OCCCC |
| InChI | InChI=1S/C37H63O9P/c1-5-9-13-16-31(41-23-24-46-47(40,44-21-11-7-3)45-22-12-8-4)18-19-32-33-25-29-15-14-17-36(34(29)26-30(33)27-35(32)38)43-28-37(39)42-20-10-6-2/h14-15,17,30-33,35,38H,5-13,16,18-28H2,1-4H3/t30-,31-,32+,33-,35+/m0/s1 |
| InChIKey | AHNHIWSKQLGRMU-WUORMFBWSA-N |
| XLogP | 8.62 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.88 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|