C32H53NO4 — CID 118098337
2-[[(1R,2R,3aS,9aS)-2-hydroxy-1-[(3S)-3-hydroxyoctyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]-N-nonan-5-ylacetamide (PubChem CID 118098337) has the molecular formula C32H53NO4 and a molecular weight of 515.78 g/mol. Its IUPAC name is 2-[[(1R,2R,3aS,9aS)-2-hydroxy-1-[(3S)-3-hydroxyoctyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]-N-nonan-5-ylacetamide.
| Compound Name | 2-[[(1R,2R,3aS,9aS)-2-hydroxy-1-[(3S)-3-hydroxyoctyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]-N-nonan-5-ylacetamide |
|---|---|
| PubChem CID | 118098337 |
| Molecular Formula | C32H53NO4 |
| Molecular Weight | 515.78 g/mol |
| Exact Mass | 515.40 |
| IUPAC Name | 2-[[(1R,2R,3aS,9aS)-2-hydroxy-1-[(3S)-3-hydroxyoctyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]-N-nonan-5-ylacetamide |
| SMILES | CCCCC[C@H](O)CC[C@@H]1[C@H]2Cc3cccc(OCC(=O)NC(CCCC)CCCC)c3C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C32H53NO4/c1-4-7-10-15-26(34)17-18-27-28-19-23-12-11-16-31(29(23)20-24(28)21-30(27)35)37-22-32(36)33-25(13-8-5-2)14-9-6-3/h11-12,16,24-28,30,34-35H,4-10,13-15,17-22H2,1-3H3,(H,33,36)/t24-,26-,27+,28-,30+/m0/s1 |
| InChIKey | NTZVXOVDETUEKD-JMLJTDODSA-N |
| XLogP | 6.36 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.78 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|