C25H36F3NO4 — CID 118147615
2-[[(1R,2R,3aS,9aS)-2-hydroxy-1-[(3S)-3-hydroxyoctyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 118147615) has the molecular formula C25H36F3NO4 and a molecular weight of 471.56 g/mol. Its IUPAC name is 2-[[(1R,2R,3aS,9aS)-2-hydroxy-1-[(3S)-3-hydroxyoctyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[[(1R,2R,3aS,9aS)-2-hydroxy-1-[(3S)-3-hydroxyoctyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 118147615 |
| Molecular Formula | C25H36F3NO4 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | 2-[[(1R,2R,3aS,9aS)-2-hydroxy-1-[(3S)-3-hydroxyoctyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | CCCCC[C@H](O)CC[C@@H]1[C@H]2Cc3cccc(OCC(=O)NCC(F)(F)F)c3C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C25H36F3NO4/c1-2-3-4-7-18(30)9-10-19-20-11-16-6-5-8-23(21(16)12-17(20)13-22(19)31)33-14-24(32)29-15-25(26,27)28/h5-6,8,17-20,22,30-31H,2-4,7,9-15H2,1H3,(H,29,32)/t17-,18-,19+,20-,22+/m0/s1 |
| InChIKey | HMYNZQJFZKGVHZ-SXFAUFNYSA-N |
| XLogP | 4.18 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|