C27H41NO4 — CID 76683418
2-[[(1R,2R,3aS,9aS)-2-hydroxy-1-[(3S)-3-hydroxyoctyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]-N-(cyclopropylmethyl)acetamide (PubChem CID 76683418) has the molecular formula C27H41NO4 and a molecular weight of 443.63 g/mol. Its IUPAC name is 2-[[(1R,2R,3aS,9aS)-2-hydroxy-1-[(3S)-3-hydroxyoctyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]-N-(cyclopropylmethyl)acetamide.
| Compound Name | 2-[[(1R,2R,3aS,9aS)-2-hydroxy-1-[(3S)-3-hydroxyoctyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]-N-(cyclopropylmethyl)acetamide |
|---|---|
| PubChem CID | 76683418 |
| Molecular Formula | C27H41NO4 |
| Molecular Weight | 443.63 g/mol |
| Exact Mass | 443.30 |
| IUPAC Name | 2-[[(1R,2R,3aS,9aS)-2-hydroxy-1-[(3S)-3-hydroxyoctyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]-N-(cyclopropylmethyl)acetamide |
| SMILES | CCCCC[C@H](O)CC[C@@H]1[C@H]2Cc3cccc(OCC(=O)NCC4CC4)c3C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C27H41NO4/c1-2-3-4-7-21(29)11-12-22-23-13-19-6-5-8-26(24(19)14-20(23)15-25(22)30)32-17-27(31)28-16-18-9-10-18/h5-6,8,18,20-23,25,29-30H,2-4,7,9-17H2,1H3,(H,28,31)/t20-,21-,22+,23-,25+/m0/s1 |
| InChIKey | QYNBBJDUHYIZPS-LYVDORBWSA-N |
| XLogP | 4.02 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.63 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|