C26H38FNO4 — CID 166119040
2-[[(1R,2R,3aS)-2-hydroxy-1-[(3S)-3-hydroxyoctyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]-N-[(2S)-2-fluorocyclopropyl]acetamide (PubChem CID 166119040) has the molecular formula C26H38FNO4 and a molecular weight of 447.59 g/mol. Its IUPAC name is 2-[[(1R,2R,3aS)-2-hydroxy-1-[(3S)-3-hydroxyoctyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]-N-[(2S)-2-fluorocyclopropyl]acetamide.
| Compound Name | 2-[[(1R,2R,3aS)-2-hydroxy-1-[(3S)-3-hydroxyoctyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]-N-[(2S)-2-fluorocyclopropyl]acetamide |
|---|---|
| PubChem CID | 166119040 |
| Molecular Formula | C26H38FNO4 |
| Molecular Weight | 447.59 g/mol |
| Exact Mass | 447.28 |
| IUPAC Name | 2-[[(1R,2R,3aS)-2-hydroxy-1-[(3S)-3-hydroxyoctyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]-N-[(2S)-2-fluorocyclopropyl]acetamide |
| SMILES | CCCCC[C@H](O)CC[C@@H]1C2Cc3cccc(OCC(=O)NC4C[C@@H]4F)c3C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C26H38FNO4/c1-2-3-4-7-18(29)9-10-19-20-11-16-6-5-8-25(21(16)12-17(20)13-24(19)30)32-15-26(31)28-23-14-22(23)27/h5-6,8,17-20,22-24,29-30H,2-4,7,9-15H2,1H3,(H,28,31)/t17-,18-,19+,20?,22-,23?,24+/m0/s1 |
| InChIKey | AIPXLHOZZLRPKE-KXSVQHDKSA-N |
| XLogP | 3.73 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.59 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|