C31H44N2O6 — CID 134571827
2-[[(1R,2R,3aS,9aS)-2-hydroxy-1-[(3S)-3-hydroxyoctyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]-N-[[hydroxy(phenylmethoxy)amino]methyl]acetamide (PubChem CID 134571827) has the molecular formula C31H44N2O6 and a molecular weight of 540.70 g/mol. Its IUPAC name is 2-[[(1R,2R,3aS,9aS)-2-hydroxy-1-[(3S)-3-hydroxyoctyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]-N-[[hydroxy(phenylmethoxy)amino]methyl]acetamide.
| Compound Name | 2-[[(1R,2R,3aS,9aS)-2-hydroxy-1-[(3S)-3-hydroxyoctyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]-N-[[hydroxy(phenylmethoxy)amino]methyl]acetamide |
|---|---|
| PubChem CID | 134571827 |
| Molecular Formula | C31H44N2O6 |
| Molecular Weight | 540.70 g/mol |
| Exact Mass | 540.32 |
| IUPAC Name | 2-[[(1R,2R,3aS,9aS)-2-hydroxy-1-[(3S)-3-hydroxyoctyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]-N-[[hydroxy(phenylmethoxy)amino]methyl]acetamide |
| SMILES | CCCCC[C@H](O)CC[C@@H]1[C@H]2Cc3cccc(OCC(=O)NCN(O)OCc4ccccc4)c3C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C31H44N2O6/c1-2-3-5-12-25(34)14-15-26-27-16-23-11-8-13-30(28(23)17-24(27)18-29(26)35)38-20-31(36)32-21-33(37)39-19-22-9-6-4-7-10-22/h4,6-11,13,24-27,29,34-35,37H,2-3,5,12,14-21H2,1H3,(H,32,36)/t24-,25-,26+,27-,29+/m0/s1 |
| InChIKey | ZRYGTSFQVWPQJH-DYXRGMLLSA-N |
| XLogP | 4.40 |
| TPSA | 111.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.70 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|