C26H40FNO4 — CID 166119050
2-[[(1R,2R,3aS,9aS)-2-hydroxy-1-[(3S)-3-hydroxyoctyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]-N-(3-fluoropropyl)acetamide (PubChem CID 166119050) has the molecular formula C26H40FNO4 and a molecular weight of 449.61 g/mol. Its IUPAC name is 2-[[(1R,2R,3aS,9aS)-2-hydroxy-1-[(3S)-3-hydroxyoctyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]-N-(3-fluoropropyl)acetamide.
| Compound Name | 2-[[(1R,2R,3aS,9aS)-2-hydroxy-1-[(3S)-3-hydroxyoctyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]-N-(3-fluoropropyl)acetamide |
|---|---|
| PubChem CID | 166119050 |
| Molecular Formula | C26H40FNO4 |
| Molecular Weight | 449.61 g/mol |
| Exact Mass | 449.29 |
| IUPAC Name | 2-[[(1R,2R,3aS,9aS)-2-hydroxy-1-[(3S)-3-hydroxyoctyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]-N-(3-fluoropropyl)acetamide |
| SMILES | CCCCC[C@H](O)CC[C@@H]1[C@H]2Cc3cccc(OCC(=O)NCCCF)c3C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C26H40FNO4/c1-2-3-4-8-20(29)10-11-21-22-14-18-7-5-9-25(23(18)15-19(22)16-24(21)30)32-17-26(31)28-13-6-12-27/h5,7,9,19-22,24,29-30H,2-4,6,8,10-17H2,1H3,(H,28,31)/t19-,20-,21+,22-,24+/m0/s1 |
| InChIKey | RNZRQDKNKBONLF-QMDPOKHVSA-N |
| XLogP | 3.97 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.61 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|