C29H45NO6 — CID 123594004
[3-methyl-1-(methylamino)-1-oxobutan-2-yl] 2-[[2-hydroxy-1-(3-hydroxyoctyl)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate (PubChem CID 123594004) has the molecular formula C29H45NO6 and a molecular weight of 503.68 g/mol. Its IUPAC name is [3-methyl-1-(methylamino)-1-oxobutan-2-yl] 2-[[2-hydroxy-1-(3-hydroxyoctyl)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate.
| Compound Name | [3-methyl-1-(methylamino)-1-oxobutan-2-yl] 2-[[2-hydroxy-1-(3-hydroxyoctyl)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate |
|---|---|
| PubChem CID | 123594004 |
| Molecular Formula | C29H45NO6 |
| Molecular Weight | 503.68 g/mol |
| Exact Mass | 503.32 |
| IUPAC Name | [3-methyl-1-(methylamino)-1-oxobutan-2-yl] 2-[[2-hydroxy-1-(3-hydroxyoctyl)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate |
| SMILES | CCCCCC(O)CCC1C(O)CC2Cc3c(cccc3OCC(=O)OC(C(=O)NC)C(C)C)CC21 |
| InChI | InChI=1S/C29H45NO6/c1-5-6-7-10-21(31)12-13-22-23-14-19-9-8-11-26(24(19)15-20(23)16-25(22)32)35-17-27(33)36-28(18(2)3)29(34)30-4/h8-9,11,18,20-23,25,28,31-32H,5-7,10,12-17H2,1-4H3,(H,30,34) |
| InChIKey | KEFGJHDJEKCXQX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.68 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|