C30H44O7 — CID 90289912
methyl 2-[[(1R,2R,3aS,9aS)-1-[(3R)-3-cyclopentyloxycarbonyloxyoctyl]-2-hydroxy-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate (PubChem CID 90289912) has the molecular formula C30H44O7 and a molecular weight of 516.68 g/mol. Its IUPAC name is methyl 2-[[(1R,2R,3aS,9aS)-1-[(3R)-3-cyclopentyloxycarbonyloxyoctyl]-2-hydroxy-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate.
| Compound Name | methyl 2-[[(1R,2R,3aS,9aS)-1-[(3R)-3-cyclopentyloxycarbonyloxyoctyl]-2-hydroxy-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate |
|---|---|
| PubChem CID | 90289912 |
| Molecular Formula | C30H44O7 |
| Molecular Weight | 516.68 g/mol |
| Exact Mass | 516.31 |
| IUPAC Name | methyl 2-[[(1R,2R,3aS,9aS)-1-[(3R)-3-cyclopentyloxycarbonyloxyoctyl]-2-hydroxy-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate |
| SMILES | CCCCC[C@H](CC[C@@H]1[C@H]2Cc3cccc(OCC(=O)OC)c3C[C@H]2C[C@H]1O)OC(=O)OC1CCCC1 |
| InChI | InChI=1S/C30H44O7/c1-3-4-5-10-23(37-30(33)36-22-11-6-7-12-22)14-15-24-25-16-20-9-8-13-28(35-19-29(32)34-2)26(20)17-21(25)18-27(24)31/h8-9,13,21-25,27,31H,3-7,10-12,14-19H2,1-2H3/t21-,23+,24+,25-,27+/m0/s1 |
| InChIKey | VNVMRDLQLUZCFW-VNXBHDGDSA-N |
| XLogP | 5.78 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.68 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|