C30H44O6 — CID 90281616
1-[2-hydroxy-5-(2-methoxy-2-oxoethoxy)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]naphthalen-1-yl]octan-3-yl cyclopentanecarboxylate (PubChem CID 90281616) has the molecular formula C30H44O6 and a molecular weight of 500.68 g/mol. Its IUPAC name is 1-[2-hydroxy-5-(2-methoxy-2-oxoethoxy)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]naphthalen-1-yl]octan-3-yl cyclopentanecarboxylate.
| Compound Name | 1-[2-hydroxy-5-(2-methoxy-2-oxoethoxy)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]naphthalen-1-yl]octan-3-yl cyclopentanecarboxylate |
|---|---|
| PubChem CID | 90281616 |
| Molecular Formula | C30H44O6 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.31 |
| IUPAC Name | 1-[2-hydroxy-5-(2-methoxy-2-oxoethoxy)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]naphthalen-1-yl]octan-3-yl cyclopentanecarboxylate |
| SMILES | CCCCCC(CCC1C(O)CC2Cc3c(cccc3OCC(=O)OC)CC21)OC(=O)C1CCCC1 |
| InChI | InChI=1S/C30H44O6/c1-3-4-5-12-23(36-30(33)20-9-6-7-10-20)14-15-24-25-16-21-11-8-13-28(35-19-29(32)34-2)26(21)17-22(25)18-27(24)31/h8,11,13,20,22-25,27,31H,3-7,9-10,12,14-19H2,1-2H3 |
| InChIKey | XIQDZVLSDUHZCM-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|