C35H54O7 — CID 146419277
[(1R,2R,3aS,9aS)-5-(2-methoxy-2-oxoethoxy)-1-[(4S)-4-(oxan-2-yloxy)nonyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]naphthalen-2-yl] 3-methylbutanoate (PubChem CID 146419277) has the molecular formula C35H54O7 and a molecular weight of 586.81 g/mol. Its IUPAC name is [(1R,2R,3aS,9aS)-5-(2-methoxy-2-oxoethoxy)-1-[(4S)-4-(oxan-2-yloxy)nonyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]naphthalen-2-yl] 3-methylbutanoate.
| Compound Name | [(1R,2R,3aS,9aS)-5-(2-methoxy-2-oxoethoxy)-1-[(4S)-4-(oxan-2-yloxy)nonyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]naphthalen-2-yl] 3-methylbutanoate |
|---|---|
| PubChem CID | 146419277 |
| Molecular Formula | C35H54O7 |
| Molecular Weight | 586.81 g/mol |
| Exact Mass | 586.39 |
| IUPAC Name | [(1R,2R,3aS,9aS)-5-(2-methoxy-2-oxoethoxy)-1-[(4S)-4-(oxan-2-yloxy)nonyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]naphthalen-2-yl] 3-methylbutanoate |
| SMILES | CCCCC[C@@H](CCC[C@@H]1[C@H]2Cc3cccc(OCC(=O)OC)c3C[C@H]2C[C@H]1OC(=O)CC(C)C)OC1CCCCO1 |
| InChI | InChI=1S/C35H54O7/c1-5-6-7-13-27(41-35-17-8-9-18-39-35)14-11-15-28-29-20-25-12-10-16-31(40-23-34(37)38-4)30(25)21-26(29)22-32(28)42-33(36)19-24(2)3/h10,12,16,24,26-29,32,35H,5-9,11,13-15,17-23H2,1-4H3/t26-,27-,28+,29-,32+,35?/m0/s1 |
| InChIKey | NRPYIBJDGDMROY-NIVIVSCNSA-N |
| XLogP | 7.21 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.81 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|