C40H59NO9Si — CID 174098238
butyl 2-[[(1R,9aS)-1-[(3S)-3-(4-nitrophenoxy)carbonyloxyoctyl]-2-triethylsilyloxy-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate (PubChem CID 174098238) has the molecular formula C40H59NO9Si and a molecular weight of 726.00 g/mol. Its IUPAC name is butyl 2-[[(1R,9aS)-1-[(3S)-3-(4-nitrophenoxy)carbonyloxyoctyl]-2-triethylsilyloxy-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate.
| Compound Name | butyl 2-[[(1R,9aS)-1-[(3S)-3-(4-nitrophenoxy)carbonyloxyoctyl]-2-triethylsilyloxy-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate |
|---|---|
| PubChem CID | 174098238 |
| Molecular Formula | C40H59NO9Si |
| Molecular Weight | 726.00 g/mol |
| Exact Mass | 725.40 |
| IUPAC Name | butyl 2-[[(1R,9aS)-1-[(3S)-3-(4-nitrophenoxy)carbonyloxyoctyl]-2-triethylsilyloxy-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate |
| SMILES | CCCCC[C@@H](CC[C@H]1C(O[Si](CC)(CC)CC)CC2Cc3c(cccc3OCC(=O)OCCCC)C[C@@H]21)OC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C40H59NO9Si/c1-6-11-13-16-32(48-40(43)49-33-20-18-31(19-21-33)41(44)45)22-23-34-35-25-29-15-14-17-37(47-28-39(42)46-24-12-7-2)36(29)26-30(35)27-38(34)50-51(8-3,9-4)10-5/h14-15,17-21,30,32,34-35,38H,6-13,16,22-28H2,1-5H3/t30?,32-,34+,35-,38?/m0/s1 |
| InChIKey | XJDMQESIWQISSF-BVUHFGNWSA-N |
| XLogP | 10.00 |
| TPSA | 123.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.00 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|