C33H41F3O7 — CID 170387303
2-[[(1R,2R,3aS,9aS)-2-hydroxy-1-[(3S)-3-[3-[4-(trifluoromethoxy)phenyl]propanoyloxy]octyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetic acid (PubChem CID 170387303) has the molecular formula C33H41F3O7 and a molecular weight of 606.68 g/mol. Its IUPAC name is 2-[[(1R,2R,3aS,9aS)-2-hydroxy-1-[(3S)-3-[3-[4-(trifluoromethoxy)phenyl]propanoyloxy]octyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetic acid.
| Compound Name | 2-[[(1R,2R,3aS,9aS)-2-hydroxy-1-[(3S)-3-[3-[4-(trifluoromethoxy)phenyl]propanoyloxy]octyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 170387303 |
| Molecular Formula | C33H41F3O7 |
| Molecular Weight | 606.68 g/mol |
| Exact Mass | 606.28 |
| IUPAC Name | 2-[[(1R,2R,3aS,9aS)-2-hydroxy-1-[(3S)-3-[3-[4-(trifluoromethoxy)phenyl]propanoyloxy]octyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetic acid |
| SMILES | CCCCC[C@@H](CC[C@@H]1[C@H]2Cc3cccc(OCC(=O)O)c3C[C@H]2C[C@H]1O)OC(=O)CCc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C33H41F3O7/c1-2-3-4-7-24(42-32(40)16-11-21-9-12-25(13-10-21)43-33(34,35)36)14-15-26-27-17-22-6-5-8-30(41-20-31(38)39)28(22)18-23(27)19-29(26)37/h5-6,8-10,12-13,23-24,26-27,29,37H,2-4,7,11,14-20H2,1H3,(H,38,39)/t23-,24-,26+,27-,29+/m0/s1 |
| InChIKey | FUZHRRVXHUCYOA-SIOLHWFBSA-N |
| XLogP | 6.67 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.68 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|