C22H30O7 — CID 155261400
(2S)-2-[2-[[(1R,2R,3aS,9aS)-2-hydroxy-1-[(3S)-3-hydroxybutyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetyl]oxypropanoic acid (PubChem CID 155261400) has the molecular formula C22H30O7 and a molecular weight of 406.48 g/mol. Its IUPAC name is (2S)-2-[2-[[(1R,2R,3aS,9aS)-2-hydroxy-1-[(3S)-3-hydroxybutyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetyl]oxypropanoic acid.
| Compound Name | (2S)-2-[2-[[(1R,2R,3aS,9aS)-2-hydroxy-1-[(3S)-3-hydroxybutyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetyl]oxypropanoic acid |
|---|---|
| PubChem CID | 155261400 |
| Molecular Formula | C22H30O7 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | (2S)-2-[2-[[(1R,2R,3aS,9aS)-2-hydroxy-1-[(3S)-3-hydroxybutyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetyl]oxypropanoic acid |
| SMILES | C[C@H](O)CC[C@@H]1[C@H]2Cc3cccc(OCC(=O)O[C@@H](C)C(=O)O)c3C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C22H30O7/c1-12(23)6-7-16-17-8-14-4-3-5-20(18(14)9-15(17)10-19(16)24)28-11-21(25)29-13(2)22(26)27/h3-5,12-13,15-17,19,23-24H,6-11H2,1-2H3,(H,26,27)/t12-,13-,15-,16+,17-,19+/m0/s1 |
| InChIKey | UJJIBESOEBQBQD-BCQMGTOTSA-N |
| XLogP | 1.95 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |