C27H40O5 — CID 145001021
oxolan-3-yl 2-[[(2R)-2-hydroxy-1-octyl-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate (PubChem CID 145001021) has the molecular formula C27H40O5 and a molecular weight of 444.61 g/mol. Its IUPAC name is oxolan-3-yl 2-[[(2R)-2-hydroxy-1-octyl-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate.
| Compound Name | oxolan-3-yl 2-[[(2R)-2-hydroxy-1-octyl-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate |
|---|---|
| PubChem CID | 145001021 |
| Molecular Formula | C27H40O5 |
| Molecular Weight | 444.61 g/mol |
| Exact Mass | 444.29 |
| IUPAC Name | oxolan-3-yl 2-[[(2R)-2-hydroxy-1-octyl-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate |
| SMILES | CCCCCCCCC1C2Cc3cccc(OCC(=O)OC4CCOC4)c3CC2C[C@H]1O |
| InChI | InChI=1S/C27H40O5/c1-2-3-4-5-6-7-10-22-23-14-19-9-8-11-26(24(19)15-20(23)16-25(22)28)31-18-27(29)32-21-12-13-30-17-21/h8-9,11,20-23,25,28H,2-7,10,12-18H2,1H3/t20?,21?,22?,23?,25-/m1/s1 |
| InChIKey | OOZQIURFWFEAHG-WNHYIRCFSA-N |
| XLogP | 4.86 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.61 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|