C35H54O11 — CID 177223232
[4-hydroxy-6-(hydroxymethyl)oxan-2-yl] 2-[[(1S,3aR,9aR)-2-[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1-octyl-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate (PubChem CID 177223232) has the molecular formula C35H54O11 and a molecular weight of 650.81 g/mol. Its IUPAC name is [4-hydroxy-6-(hydroxymethyl)oxan-2-yl] 2-[[(1S,3aR,9aR)-2-[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1-octyl-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate.
| Compound Name | [4-hydroxy-6-(hydroxymethyl)oxan-2-yl] 2-[[(1S,3aR,9aR)-2-[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1-octyl-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate |
|---|---|
| PubChem CID | 177223232 |
| Molecular Formula | C35H54O11 |
| Molecular Weight | 650.81 g/mol |
| Exact Mass | 650.37 |
| IUPAC Name | [4-hydroxy-6-(hydroxymethyl)oxan-2-yl] 2-[[(1S,3aR,9aR)-2-[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1-octyl-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate |
| SMILES | CCCCCCCC[C@@H]1C(OC2CC(O)C(O)C(CO)O2)C[C@H]2Cc3c(cccc3OCC(=O)OC3CC(O)CC(CO)O3)C[C@H]21 |
| InChI | InChI=1S/C35H54O11/c1-2-3-4-5-6-7-10-25-26-12-21-9-8-11-29(42-20-32(40)46-33-16-23(38)15-24(18-36)43-33)27(21)13-22(26)14-30(25)44-34-17-28(39)35(41)31(19-37)45-34/h8-9,11,22-26,28,30-31,33-39,41H,2-7,10,12-20H2,1H3/t22-,23?,24?,25+,26-,28?,30?,31?,33?,34?,35?/m1/s1 |
| InChIKey | NOINFLNYTNHZDL-KLEGBLJESA-N |
| XLogP | 2.78 |
| TPSA | 164.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.81 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|