C29H44O8 — CID 177223235
[(5S)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] 2-[[(1S,9aR)-2-hydroxy-1-octyl-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate (PubChem CID 177223235) has the molecular formula C29H44O8 and a molecular weight of 520.66 g/mol. Its IUPAC name is [(5S)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] 2-[[(1S,9aR)-2-hydroxy-1-octyl-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate.
| Compound Name | [(5S)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] 2-[[(1S,9aR)-2-hydroxy-1-octyl-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate |
|---|---|
| PubChem CID | 177223235 |
| Molecular Formula | C29H44O8 |
| Molecular Weight | 520.66 g/mol |
| Exact Mass | 520.30 |
| IUPAC Name | [(5S)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] 2-[[(1S,9aR)-2-hydroxy-1-octyl-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate |
| SMILES | CCCCCCCC[C@@H]1C(O)CC2Cc3c(cccc3OCC(=O)OC3CC(O)[C@H](O)C(CO)O3)C[C@H]21 |
| InChI | InChI=1S/C29H44O8/c1-2-3-4-5-6-7-10-20-21-12-18-9-8-11-25(22(18)13-19(21)14-23(20)31)35-17-27(33)37-28-15-24(32)29(34)26(16-30)36-28/h8-9,11,19-21,23-24,26,28-32,34H,2-7,10,12-17H2,1H3/t19?,20-,21+,23?,24?,26?,28?,29-/m0/s1 |
| InChIKey | WIYUHVWSXOBQLH-ANZKJIADSA-N |
| XLogP | 2.90 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.66 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|