C29H45NO4 — CID 144530197
3-[3-[[(2R)-2-hydroxy-1-octyl-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]prop-1-en-2-yloxy]pentanamide (PubChem CID 144530197) has the molecular formula C29H45NO4 and a molecular weight of 471.68 g/mol. Its IUPAC name is 3-[3-[[(2R)-2-hydroxy-1-octyl-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]prop-1-en-2-yloxy]pentanamide.
| Compound Name | 3-[3-[[(2R)-2-hydroxy-1-octyl-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]prop-1-en-2-yloxy]pentanamide |
|---|---|
| PubChem CID | 144530197 |
| Molecular Formula | C29H45NO4 |
| Molecular Weight | 471.68 g/mol |
| Exact Mass | 471.33 |
| IUPAC Name | 3-[3-[[(2R)-2-hydroxy-1-octyl-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]prop-1-en-2-yloxy]pentanamide |
| SMILES | C=C(COc1cccc2c1CC1C[C@@H](O)C(CCCCCCCC)C1C2)OC(CC)CC(N)=O |
| InChI | InChI=1S/C29H45NO4/c1-4-6-7-8-9-10-13-24-25-15-21-12-11-14-28(26(21)16-22(25)17-27(24)31)33-19-20(3)34-23(5-2)18-29(30)32/h11-12,14,22-25,27,31H,3-10,13,15-19H2,1-2H3,(H2,30,32)/t22?,23?,24?,25?,27-/m1/s1 |
| InChIKey | IGRXVWXPEZBYMX-GQVMTYFFSA-N |
| XLogP | 5.71 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.68 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|