C22H40O5 — CID 14772965
ethyl 7-[3,5-dihydroxy-2-(3-oxooctyl)cyclopentyl]heptanoate (PubChem CID 14772965) has the molecular formula C22H40O5 and a molecular weight of 384.56 g/mol. Its IUPAC name is ethyl 7-[3,5-dihydroxy-2-(3-oxooctyl)cyclopentyl]heptanoate.
| Compound Name | ethyl 7-[3,5-dihydroxy-2-(3-oxooctyl)cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 14772965 |
| Molecular Formula | C22H40O5 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.29 |
| IUPAC Name | ethyl 7-[3,5-dihydroxy-2-(3-oxooctyl)cyclopentyl]heptanoate |
| SMILES | CCCCCC(=O)CCC1C(O)CC(O)C1CCCCCCC(=O)OCC |
| InChI | InChI=1S/C22H40O5/c1-3-5-8-11-17(23)14-15-19-18(20(24)16-21(19)25)12-9-6-7-10-13-22(26)27-4-2/h18-21,24-25H,3-16H2,1-2H3 |
| InChIKey | JKASAWNCQFEQEW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|