C21H34O5 — CID 173462324
ethyl 5-[3,5-dihydroxy-2-(3-oxooctyl)cyclopentyl]-3-methylpenta-2,4-dienoate (PubChem CID 173462324) has the molecular formula C21H34O5 and a molecular weight of 366.50 g/mol. Its IUPAC name is ethyl 5-[3,5-dihydroxy-2-(3-oxooctyl)cyclopentyl]-3-methylpenta-2,4-dienoate.
| Compound Name | ethyl 5-[3,5-dihydroxy-2-(3-oxooctyl)cyclopentyl]-3-methylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 173462324 |
| Molecular Formula | C21H34O5 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | ethyl 5-[3,5-dihydroxy-2-(3-oxooctyl)cyclopentyl]-3-methylpenta-2,4-dienoate |
| SMILES | CCCCCC(=O)CCC1C(O)CC(O)C1C=CC(C)=CC(=O)OCC |
| InChI | InChI=1S/C21H34O5/c1-4-6-7-8-16(22)10-12-18-17(19(23)14-20(18)24)11-9-15(3)13-21(25)26-5-2/h9,11,13,17-20,23-24H,4-8,10,12,14H2,1-3H3 |
| InChIKey | HAQPVCJUGVNNBX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|