C23H42O6 — CID 70597333
8-[(1R,2R,3R,5S)-2-[(E)-3,4-dihydroxydec-1-enyl]-3,5-dihydroxycyclopentyl]-1-hydroxyoctan-2-one (PubChem CID 70597333) has the molecular formula C23H42O6 and a molecular weight of 414.58 g/mol. Its IUPAC name is 8-[(1R,2R,3R,5S)-2-[(E)-3,4-dihydroxydec-1-enyl]-3,5-dihydroxycyclopentyl]-1-hydroxyoctan-2-one.
| Compound Name | 8-[(1R,2R,3R,5S)-2-[(E)-3,4-dihydroxydec-1-enyl]-3,5-dihydroxycyclopentyl]-1-hydroxyoctan-2-one |
|---|---|
| PubChem CID | 70597333 |
| Molecular Formula | C23H42O6 |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.30 |
| IUPAC Name | 8-[(1R,2R,3R,5S)-2-[(E)-3,4-dihydroxydec-1-enyl]-3,5-dihydroxycyclopentyl]-1-hydroxyoctan-2-one |
| SMILES | CCCCCCC(O)C(O)/C=C/[C@@H]1[C@@H](CCCCCCC(=O)CO)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C23H42O6/c1-2-3-4-9-12-20(26)21(27)14-13-19-18(22(28)15-23(19)29)11-8-6-5-7-10-17(25)16-24/h13-14,18-24,26-29H,2-12,15-16H2,1H3/b14-13+/t18-,19-,20?,21?,22+,23-/m1/s1 |
| InChIKey | ALUVZXQSLUUZLN-SPMXPROSSA-N |
| XLogP | 2.49 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|