C22H41NO5 — CID 54761722
7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]-N-(2-hydroxyethyl)heptanamide (PubChem CID 54761722) has the molecular formula C22H41NO5 and a molecular weight of 399.57 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]-N-(2-hydroxyethyl)heptanamide.
| Compound Name | 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]-N-(2-hydroxyethyl)heptanamide |
|---|---|
| PubChem CID | 54761722 |
| Molecular Formula | C22H41NO5 |
| Molecular Weight | 399.57 g/mol |
| Exact Mass | 399.30 |
| IUPAC Name | 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]-N-(2-hydroxyethyl)heptanamide |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@@H](CCCCCCC(=O)NCCO)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C22H41NO5/c1-2-3-6-9-17(25)12-13-19-18(20(26)16-21(19)27)10-7-4-5-8-11-22(28)23-14-15-24/h12-13,17-21,24-27H,2-11,14-16H2,1H3,(H,23,28)/b13-12+/t17-,18+,19+,20-,21+/m0/s1 |
| InChIKey | XCQNZKQRFURTLP-XFMDGEEZSA-N |
| XLogP | 2.29 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.57 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|