C22H37N3O4S — CID 54761904
7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]-N-(1,3,4-thiadiazol-2-yl)heptanamide (PubChem CID 54761904) has the molecular formula C22H37N3O4S and a molecular weight of 439.62 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]-N-(1,3,4-thiadiazol-2-yl)heptanamide.
| Compound Name | 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]-N-(1,3,4-thiadiazol-2-yl)heptanamide |
|---|---|
| PubChem CID | 54761904 |
| Molecular Formula | C22H37N3O4S |
| Molecular Weight | 439.62 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]-N-(1,3,4-thiadiazol-2-yl)heptanamide |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@@H](CCCCCCC(=O)Nc2nncs2)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C22H37N3O4S/c1-2-3-6-9-16(26)12-13-18-17(19(27)14-20(18)28)10-7-4-5-8-11-21(29)24-22-25-23-15-30-22/h12-13,15-20,26-28H,2-11,14H2,1H3,(H,24,25,29)/b13-12+/t16-,17+,18+,19-,20+/m0/s1 |
| InChIKey | LYDZUFLSCDFMOJ-YYFRNVAQSA-N |
| XLogP | 3.67 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.62 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|