C20H30O5 — CID 88845017
(2E,4E,6E)-7-[(1S,2R,3R,5S)-3,5-dihydroxy-2-(3-oxooctyl)cyclopentyl]hepta-2,4,6-trienoic acid (PubChem CID 88845017) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is (2E,4E,6E)-7-[(1S,2R,3R,5S)-3,5-dihydroxy-2-(3-oxooctyl)cyclopentyl]hepta-2,4,6-trienoic acid.
| Compound Name | (2E,4E,6E)-7-[(1S,2R,3R,5S)-3,5-dihydroxy-2-(3-oxooctyl)cyclopentyl]hepta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 88845017 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (2E,4E,6E)-7-[(1S,2R,3R,5S)-3,5-dihydroxy-2-(3-oxooctyl)cyclopentyl]hepta-2,4,6-trienoic acid |
| SMILES | CCCCCC(=O)CC[C@@H]1[C@H](/C=C/C=C/C=C/C(=O)O)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C20H30O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h4-5,7-8,10-11,16-19,22-23H,2-3,6,9,12-14H2,1H3,(H,24,25)/b5-4+,10-7+,11-8+/t16-,17+,18-,19+/m0/s1 |
| InChIKey | JKWRHCWGIOZQII-IHYLQHLISA-N |
| XLogP | 3.03 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|