C15H28O4 — CID 59071370
methyl 7-[(2R,3R,5S)-2-ethyl-3,5-dihydroxycyclopentyl]heptanoate (PubChem CID 59071370) has the molecular formula C15H28O4 and a molecular weight of 272.38 g/mol. Its IUPAC name is methyl 7-[(2R,3R,5S)-2-ethyl-3,5-dihydroxycyclopentyl]heptanoate.
| Compound Name | methyl 7-[(2R,3R,5S)-2-ethyl-3,5-dihydroxycyclopentyl]heptanoate |
|---|---|
| PubChem CID | 59071370 |
| Molecular Formula | C15H28O4 |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | methyl 7-[(2R,3R,5S)-2-ethyl-3,5-dihydroxycyclopentyl]heptanoate |
| SMILES | CC[C@@H]1C(CCCCCCC(=O)OC)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C15H28O4/c1-3-11-12(14(17)10-13(11)16)8-6-4-5-7-9-15(18)19-2/h11-14,16-17H,3-10H2,1-2H3/t11-,12?,13-,14+/m1/s1 |
| InChIKey | PEXFUIVTMNSYSU-RLAWYHOSSA-N |
| XLogP | 2.27 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|