C20H35ClO5 — CID 57314299
methyl 7-[(1R,2R,3R,5S)-2-(7-chloroheptanoyl)-3,5-dihydroxycyclopentyl]heptanoate (PubChem CID 57314299) has the molecular formula C20H35ClO5 and a molecular weight of 390.95 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R,5S)-2-(7-chloroheptanoyl)-3,5-dihydroxycyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2R,3R,5S)-2-(7-chloroheptanoyl)-3,5-dihydroxycyclopentyl]heptanoate |
|---|---|
| PubChem CID | 57314299 |
| Molecular Formula | C20H35ClO5 |
| Molecular Weight | 390.95 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | methyl 7-[(1R,2R,3R,5S)-2-(7-chloroheptanoyl)-3,5-dihydroxycyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCC[C@@H]1[C@@H](C(=O)CCCCCCCl)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C20H35ClO5/c1-26-19(25)12-8-3-2-6-10-15-17(23)14-18(24)20(15)16(22)11-7-4-5-9-13-21/h15,17-18,20,23-24H,2-14H2,1H3/t15-,17-,18+,20-/m0/s1 |
| InChIKey | XGWSIHHLAUYYQN-BOLBYERCSA-N |
| XLogP | 3.62 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.95 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|