C19H36O2 — CID 14389759
methyl 9-[(1R,2R)-2-butylcyclopentyl]nonanoate (PubChem CID 14389759) has the molecular formula C19H36O2 and a molecular weight of 296.50 g/mol. Its IUPAC name is methyl 9-[(1R,2R)-2-butylcyclopentyl]nonanoate.
| Compound Name | methyl 9-[(1R,2R)-2-butylcyclopentyl]nonanoate |
|---|---|
| PubChem CID | 14389759 |
| Molecular Formula | C19H36O2 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.27 |
| IUPAC Name | methyl 9-[(1R,2R)-2-butylcyclopentyl]nonanoate |
| SMILES | CCCC[C@@H]1CCC[C@H]1CCCCCCCCC(=O)OC |
| InChI | InChI=1S/C19H36O2/c1-3-4-12-17-14-11-15-18(17)13-9-7-5-6-8-10-16-19(20)21-2/h17-18H,3-16H2,1-2H3/t17-,18-/m1/s1 |
| InChIKey | LFIBOCIUNNYIJD-QZTJIDSGSA-N |
| XLogP | 5.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|