C20H39NO2 — CID 57160664
methyl 7-[(1R,2S,6S)-2-amino-6-hexylcyclohexyl]heptanoate (PubChem CID 57160664) has the molecular formula C20H39NO2 and a molecular weight of 325.54 g/mol. Its IUPAC name is methyl 7-[(1R,2S,6S)-2-amino-6-hexylcyclohexyl]heptanoate.
| Compound Name | methyl 7-[(1R,2S,6S)-2-amino-6-hexylcyclohexyl]heptanoate |
|---|---|
| PubChem CID | 57160664 |
| Molecular Formula | C20H39NO2 |
| Molecular Weight | 325.54 g/mol |
| Exact Mass | 325.30 |
| IUPAC Name | methyl 7-[(1R,2S,6S)-2-amino-6-hexylcyclohexyl]heptanoate |
| SMILES | CCCCCC[C@H]1CCC[C@H](N)[C@@H]1CCCCCCC(=O)OC |
| InChI | InChI=1S/C20H39NO2/c1-3-4-5-8-12-17-13-11-15-19(21)18(17)14-9-6-7-10-16-20(22)23-2/h17-19H,3-16,21H2,1-2H3/t17-,18+,19-/m0/s1 |
| InChIKey | TYZRSHPDEPZIPE-OTWHNJEPSA-N |
| XLogP | 5.21 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.54 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|