C30H52O3 — CID 59435270
1-(5-oxo-2,3,3a,4,6,6a-hexahydro-1H-pentalen-1-yl)docosane-5,14-dione (PubChem CID 59435270) has the molecular formula C30H52O3 and a molecular weight of 460.74 g/mol. Its IUPAC name is 1-(5-oxo-2,3,3a,4,6,6a-hexahydro-1H-pentalen-1-yl)docosane-5,14-dione.
| Compound Name | 1-(5-oxo-2,3,3a,4,6,6a-hexahydro-1H-pentalen-1-yl)docosane-5,14-dione |
|---|---|
| PubChem CID | 59435270 |
| Molecular Formula | C30H52O3 |
| Molecular Weight | 460.74 g/mol |
| Exact Mass | 460.39 |
| IUPAC Name | 1-(5-oxo-2,3,3a,4,6,6a-hexahydro-1H-pentalen-1-yl)docosane-5,14-dione |
| SMILES | CCCCCCCCC(=O)CCCCCCCCC(=O)CCCCC1CCC2CC(=O)CC12 |
| InChI | InChI=1S/C30H52O3/c1-2-3-4-5-8-11-17-27(31)18-12-9-6-7-10-13-19-28(32)20-15-14-16-25-21-22-26-23-29(33)24-30(25)26/h25-26,30H,2-24H2,1H3 |
| InChIKey | IEDGCRYAPMHTDO-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.74 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|