C16H26O5 — CID 21322074
3-[3-hydroxy-5-oxo-2-(3-oxooctyl)cyclopentyl]propanoic acid (PubChem CID 21322074) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is 3-[3-hydroxy-5-oxo-2-(3-oxooctyl)cyclopentyl]propanoic acid.
| Compound Name | 3-[3-hydroxy-5-oxo-2-(3-oxooctyl)cyclopentyl]propanoic acid |
|---|---|
| PubChem CID | 21322074 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 3-[3-hydroxy-5-oxo-2-(3-oxooctyl)cyclopentyl]propanoic acid |
| SMILES | CCCCCC(=O)CCC1C(O)CC(=O)C1CCC(=O)O |
| InChI | InChI=1S/C16H26O5/c1-2-3-4-5-11(17)6-7-12-13(8-9-16(20)21)15(19)10-14(12)18/h12-14,18H,2-10H2,1H3,(H,20,21) |
| InChIKey | FGACPXKRXBKDQL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|