C15H22O7 — CID 71751558
8-[(1R,2R,5R)-2-(carboxymethyl)-5-hydroxy-3-oxocyclopentyl]-6-oxooctanoic acid (PubChem CID 71751558) has the molecular formula C15H22O7 and a molecular weight of 314.33 g/mol. Its IUPAC name is 8-[(1R,2R,5R)-2-(carboxymethyl)-5-hydroxy-3-oxocyclopentyl]-6-oxooctanoic acid.
| Compound Name | 8-[(1R,2R,5R)-2-(carboxymethyl)-5-hydroxy-3-oxocyclopentyl]-6-oxooctanoic acid |
|---|---|
| PubChem CID | 71751558 |
| Molecular Formula | C15H22O7 |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 8-[(1R,2R,5R)-2-(carboxymethyl)-5-hydroxy-3-oxocyclopentyl]-6-oxooctanoic acid |
| SMILES | O=C(O)CCCCC(=O)CC[C@H]1[C@H](O)CC(=O)[C@@H]1CC(=O)O |
| InChI | InChI=1S/C15H22O7/c16-9(3-1-2-4-14(19)20)5-6-10-11(7-15(21)22)13(18)8-12(10)17/h10-12,17H,1-8H2,(H,19,20)(H,21,22)/t10-,11-,12-/m1/s1 |
| InChIKey | JQPGYJSSJIANAB-IJLUTSLNSA-N |
| XLogP | 1.02 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|