C12H19BrO4 — CID 20556063
7-(2-bromo-3-hydroxy-5-oxocyclopentyl)heptanoic acid (PubChem CID 20556063) has the molecular formula C12H19BrO4 and a molecular weight of 307.18 g/mol. Its IUPAC name is 7-(2-bromo-3-hydroxy-5-oxocyclopentyl)heptanoic acid.
| Compound Name | 7-(2-bromo-3-hydroxy-5-oxocyclopentyl)heptanoic acid |
|---|---|
| PubChem CID | 20556063 |
| Molecular Formula | C12H19BrO4 |
| Molecular Weight | 307.18 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 7-(2-bromo-3-hydroxy-5-oxocyclopentyl)heptanoic acid |
| SMILES | O=C(O)CCCCCCC1C(=O)CC(O)C1Br |
| InChI | InChI=1S/C12H19BrO4/c13-12-8(9(14)7-10(12)15)5-3-1-2-4-6-11(16)17/h8,10,12,15H,1-7H2,(H,16,17) |
| InChIKey | SEJPQYKHJVHYQW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.18 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|