C20H24F2O4 — CID 18623891
7-[2-[(E)-2-(3,5-difluorophenyl)ethenyl]-3-hydroxy-5-oxocyclopentyl]heptanoic acid (PubChem CID 18623891) has the molecular formula C20H24F2O4 and a molecular weight of 366.40 g/mol. Its IUPAC name is 7-[2-[(E)-2-(3,5-difluorophenyl)ethenyl]-3-hydroxy-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 7-[2-[(E)-2-(3,5-difluorophenyl)ethenyl]-3-hydroxy-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 18623891 |
| Molecular Formula | C20H24F2O4 |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 7-[2-[(E)-2-(3,5-difluorophenyl)ethenyl]-3-hydroxy-5-oxocyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCCC1C(=O)CC(O)C1/C=C/c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C20H24F2O4/c21-14-9-13(10-15(22)11-14)7-8-17-16(18(23)12-19(17)24)5-3-1-2-4-6-20(25)26/h7-11,16-17,19,24H,1-6,12H2,(H,25,26)/b8-7+ |
| InChIKey | NHVRRPSAUFASQE-BQYQJAHWSA-N |
| XLogP | 3.97 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|