C21H26O6 — CID 70006777
7-[2-[2-(1,3-benzodioxol-5-yl)ethenyl]-3-hydroxy-5-oxocyclopentyl]heptanoic acid (PubChem CID 70006777) has the molecular formula C21H26O6 and a molecular weight of 374.43 g/mol. Its IUPAC name is 7-[2-[2-(1,3-benzodioxol-5-yl)ethenyl]-3-hydroxy-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 7-[2-[2-(1,3-benzodioxol-5-yl)ethenyl]-3-hydroxy-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 70006777 |
| Molecular Formula | C21H26O6 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 7-[2-[2-(1,3-benzodioxol-5-yl)ethenyl]-3-hydroxy-5-oxocyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCCC1C(=O)CC(O)C1C=Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H26O6/c22-17-12-18(23)16(15(17)5-3-1-2-4-6-21(24)25)9-7-14-8-10-19-20(11-14)27-13-26-19/h7-11,15-16,18,23H,1-6,12-13H2,(H,24,25) |
| InChIKey | JPQFCLSWLBHQCY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|