C22H32O5 — CID 11955406
7-[(1R,2S,3R)-3-hydroxy-2-[4-(1-hydroxy-2-methylpropan-2-yl)phenyl]-5-oxocyclopentyl]heptanoic acid (PubChem CID 11955406) has the molecular formula C22H32O5 and a molecular weight of 376.49 g/mol. Its IUPAC name is 7-[(1R,2S,3R)-3-hydroxy-2-[4-(1-hydroxy-2-methylpropan-2-yl)phenyl]-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2S,3R)-3-hydroxy-2-[4-(1-hydroxy-2-methylpropan-2-yl)phenyl]-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 11955406 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 7-[(1R,2S,3R)-3-hydroxy-2-[4-(1-hydroxy-2-methylpropan-2-yl)phenyl]-5-oxocyclopentyl]heptanoic acid |
| SMILES | CC(C)(CO)c1ccc([C@H]2[C@H](O)CC(=O)[C@@H]2CCCCCCC(=O)O)cc1 |
| InChI | InChI=1S/C22H32O5/c1-22(2,14-23)16-11-9-15(10-12-16)21-17(18(24)13-19(21)25)7-5-3-4-6-8-20(26)27/h9-12,17,19,21,23,25H,3-8,13-14H2,1-2H3,(H,26,27)/t17-,19+,21+/m0/s1 |
| InChIKey | HNJALCPDBOOKTH-FBBABVLZSA-N |
| XLogP | 3.42 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|