C26H38O5 — CID 11955382
7-[(1R,2S,3R)-3-hydroxy-2-[4-[hydroxy-(1-propylcyclobutyl)methyl]phenyl]-5-oxocyclopentyl]heptanoic acid (PubChem CID 11955382) has the molecular formula C26H38O5 and a molecular weight of 430.59 g/mol. Its IUPAC name is 7-[(1R,2S,3R)-3-hydroxy-2-[4-[hydroxy-(1-propylcyclobutyl)methyl]phenyl]-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2S,3R)-3-hydroxy-2-[4-[hydroxy-(1-propylcyclobutyl)methyl]phenyl]-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 11955382 |
| Molecular Formula | C26H38O5 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | 7-[(1R,2S,3R)-3-hydroxy-2-[4-[hydroxy-(1-propylcyclobutyl)methyl]phenyl]-5-oxocyclopentyl]heptanoic acid |
| SMILES | CCCC1(C(O)c2ccc([C@H]3[C@H](O)CC(=O)[C@@H]3CCCCCCC(=O)O)cc2)CCC1 |
| InChI | InChI=1S/C26H38O5/c1-2-14-26(15-7-16-26)25(31)19-12-10-18(11-13-19)24-20(21(27)17-22(24)28)8-5-3-4-6-9-23(29)30/h10-13,20,22,24-25,28,31H,2-9,14-17H2,1H3,(H,29,30)/t20-,22+,24+,25?/m0/s1 |
| InChIKey | SAGFSXDZSAWPFP-QYJPUHJCSA-N |
| XLogP | 5.15 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|