C23H34BrNO6S — CID 23650240
5-[[4-bromo-2-[4-[hydroxy-(1-propylcyclobutyl)methyl]phenyl]-1,1-dioxo-1,2-thiazolidin-3-yl]methoxy]pentanoic acid (PubChem CID 23650240) has the molecular formula C23H34BrNO6S and a molecular weight of 532.50 g/mol. Its IUPAC name is 5-[[4-bromo-2-[4-[hydroxy-(1-propylcyclobutyl)methyl]phenyl]-1,1-dioxo-1,2-thiazolidin-3-yl]methoxy]pentanoic acid.
| Compound Name | 5-[[4-bromo-2-[4-[hydroxy-(1-propylcyclobutyl)methyl]phenyl]-1,1-dioxo-1,2-thiazolidin-3-yl]methoxy]pentanoic acid |
|---|---|
| PubChem CID | 23650240 |
| Molecular Formula | C23H34BrNO6S |
| Molecular Weight | 532.50 g/mol |
| Exact Mass | 531.13 |
| IUPAC Name | 5-[[4-bromo-2-[4-[hydroxy-(1-propylcyclobutyl)methyl]phenyl]-1,1-dioxo-1,2-thiazolidin-3-yl]methoxy]pentanoic acid |
| SMILES | CCCC1(C(O)c2ccc(N3C(COCCCCC(=O)O)C(Br)CS3(=O)=O)cc2)CCC1 |
| InChI | InChI=1S/C23H34BrNO6S/c1-2-11-23(12-5-13-23)22(28)17-7-9-18(10-8-17)25-20(19(24)16-32(25,29)30)15-31-14-4-3-6-21(26)27/h7-10,19-20,22,28H,2-6,11-16H2,1H3,(H,26,27) |
| InChIKey | HXQXWAUICXDWCX-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.50 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|