C26H39NO4 — CID 24767944
7-[1-[4-[hydroxy-(1-propylcyclobutyl)methyl]phenyl]-6-oxopiperidin-2-yl]heptanoic acid (PubChem CID 24767944) has the molecular formula C26H39NO4 and a molecular weight of 429.60 g/mol. Its IUPAC name is 7-[1-[4-[hydroxy-(1-propylcyclobutyl)methyl]phenyl]-6-oxopiperidin-2-yl]heptanoic acid.
| Compound Name | 7-[1-[4-[hydroxy-(1-propylcyclobutyl)methyl]phenyl]-6-oxopiperidin-2-yl]heptanoic acid |
|---|---|
| PubChem CID | 24767944 |
| Molecular Formula | C26H39NO4 |
| Molecular Weight | 429.60 g/mol |
| Exact Mass | 429.29 |
| IUPAC Name | 7-[1-[4-[hydroxy-(1-propylcyclobutyl)methyl]phenyl]-6-oxopiperidin-2-yl]heptanoic acid |
| SMILES | CCCC1(C(O)c2ccc(N3C(=O)CCCC3CCCCCCC(=O)O)cc2)CCC1 |
| InChI | InChI=1S/C26H39NO4/c1-2-17-26(18-8-19-26)25(31)20-13-15-22(16-14-20)27-21(10-7-11-23(27)28)9-5-3-4-6-12-24(29)30/h13-16,21,25,31H,2-12,17-19H2,1H3,(H,29,30) |
| InChIKey | XQVUKSYRUDCMFQ-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.60 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|